C18H20FN3O5S — CID 9327605
N-[(2S)-1-[2-(4-ethoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]-4-fluorobenzenesulfonamide (PubChem CID 9327605) has the molecular formula C18H20FN3O5S and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[(2S)-1-[2-(4-ethoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(2S)-1-[2-(4-ethoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 9327605 |
| Molecular Formula | C18H20FN3O5S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[(2S)-1-[2-(4-ethoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]-4-fluorobenzenesulfonamide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)[C@H](C)NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FN3O5S/c1-3-27-15-8-4-13(5-9-15)18(24)21-20-17(23)12(2)22-28(25,26)16-10-6-14(19)7-11-16/h4-12,22H,3H2,1-2H3,(H,20,23)(H,21,24)/t12-/m0/s1 |
| InChIKey | JOTAACZRXCMPIP-LBPRGKRZSA-N |
| XLogP | 1.35 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|