C20H24FN3O5S — CID 97000634
4-[[(2R)-1-[4-(4-fluorophenoxy)butylamino]-1-oxopropan-2-yl]sulfamoyl]benzamide (PubChem CID 97000634) has the molecular formula C20H24FN3O5S and a molecular weight of 437.49 g/mol. Its IUPAC name is 4-[[(2R)-1-[4-(4-fluorophenoxy)butylamino]-1-oxopropan-2-yl]sulfamoyl]benzamide.
| Compound Name | 4-[[(2R)-1-[4-(4-fluorophenoxy)butylamino]-1-oxopropan-2-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 97000634 |
| Molecular Formula | C20H24FN3O5S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 4-[[(2R)-1-[4-(4-fluorophenoxy)butylamino]-1-oxopropan-2-yl]sulfamoyl]benzamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(C(N)=O)cc1)C(=O)NCCCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FN3O5S/c1-14(24-30(27,28)18-10-4-15(5-11-18)19(22)25)20(26)23-12-2-3-13-29-17-8-6-16(21)7-9-17/h4-11,14,24H,2-3,12-13H2,1H3,(H2,22,25)(H,23,26)/t14-/m1/s1 |
| InChIKey | AKLGWJFOMCMJFT-CQSZACIVSA-N |
| XLogP | 1.57 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|