C12H17ClN2O5S — CID 87400365
(2R)-2-[[4-(3-chloropropoxy)phenyl]sulfonylamino]-N-hydroxypropanamide (PubChem CID 87400365) has the molecular formula C12H17ClN2O5S and a molecular weight of 336.80 g/mol. Its IUPAC name is (2R)-2-[[4-(3-chloropropoxy)phenyl]sulfonylamino]-N-hydroxypropanamide.
| Compound Name | (2R)-2-[[4-(3-chloropropoxy)phenyl]sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 87400365 |
| Molecular Formula | C12H17ClN2O5S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (2R)-2-[[4-(3-chloropropoxy)phenyl]sulfonylamino]-N-hydroxypropanamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(OCCCCl)cc1)C(=O)NO |
| InChI | InChI=1S/C12H17ClN2O5S/c1-9(12(16)14-17)15-21(18,19)11-5-3-10(4-6-11)20-8-2-7-13/h3-6,9,15,17H,2,7-8H2,1H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | QMAXOURYJUPASC-SECBINFHSA-N |
| XLogP | 0.87 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|