C13H20N2O5S — CID 94799409
(2R)-2-[[4-(2-ethoxyethoxy)phenyl]sulfonylamino]propanamide (PubChem CID 94799409) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is (2R)-2-[[4-(2-ethoxyethoxy)phenyl]sulfonylamino]propanamide.
| Compound Name | (2R)-2-[[4-(2-ethoxyethoxy)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 94799409 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2R)-2-[[4-(2-ethoxyethoxy)phenyl]sulfonylamino]propanamide |
| SMILES | CCOCCOc1ccc(S(=O)(=O)N[C@H](C)C(N)=O)cc1 |
| InChI | InChI=1S/C13H20N2O5S/c1-3-19-8-9-20-11-4-6-12(7-5-11)21(17,18)15-10(2)13(14)16/h4-7,10,15H,3,8-9H2,1-2H3,(H2,14,16)/t10-/m1/s1 |
| InChIKey | TUMVMZYVMLWLEG-SNVBAGLBSA-N |
| XLogP | 0.25 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|