C24H34N4O6S2 — CID 23246042
(2S)-2-[(4-methylphenyl)sulfonylamino]-N-[4-[[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]butyl]propanamide (PubChem CID 23246042) has the molecular formula C24H34N4O6S2 and a molecular weight of 538.69 g/mol. Its IUPAC name is (2S)-2-[(4-methylphenyl)sulfonylamino]-N-[4-[[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]butyl]propanamide.
| Compound Name | (2S)-2-[(4-methylphenyl)sulfonylamino]-N-[4-[[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]butyl]propanamide |
|---|---|
| PubChem CID | 23246042 |
| Molecular Formula | C24H34N4O6S2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | (2S)-2-[(4-methylphenyl)sulfonylamino]-N-[4-[[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]butyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NCCCCNC(=O)[C@H](C)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H34N4O6S2/c1-17-7-11-21(12-8-17)35(31,32)27-19(3)23(29)25-15-5-6-16-26-24(30)20(4)28-36(33,34)22-13-9-18(2)10-14-22/h7-14,19-20,27-28H,5-6,15-16H2,1-4H3,(H,25,29)(H,26,30)/t19-,20-/m0/s1 |
| InChIKey | ZYWWVKZMISBOJR-PMACEKPBSA-N |
| XLogP | 1.35 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|