C16H26N2O3S — CID 7230015
(2R)-N-hexyl-2-[(4-methylphenyl)sulfonylamino]propanamide (PubChem CID 7230015) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is (2R)-N-hexyl-2-[(4-methylphenyl)sulfonylamino]propanamide.
| Compound Name | (2R)-N-hexyl-2-[(4-methylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 7230015 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (2R)-N-hexyl-2-[(4-methylphenyl)sulfonylamino]propanamide |
| SMILES | CCCCCCNC(=O)[C@@H](C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-4-5-6-7-12-17-16(19)14(3)18-22(20,21)15-10-8-13(2)9-11-15/h8-11,14,18H,4-7,12H2,1-3H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | AHCNLBKQYJOHTF-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|