C14H21FN2O4S — CID 5181222
N-(3-ethoxypropyl)-2-[(4-fluorophenyl)sulfonylamino]propanamide (PubChem CID 5181222) has the molecular formula C14H21FN2O4S and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[(4-fluorophenyl)sulfonylamino]propanamide.
| Compound Name | N-(3-ethoxypropyl)-2-[(4-fluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 5181222 |
| Molecular Formula | C14H21FN2O4S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[(4-fluorophenyl)sulfonylamino]propanamide |
| SMILES | CCOCCCNC(=O)C(C)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2O4S/c1-3-21-10-4-9-16-14(18)11(2)17-22(19,20)13-7-5-12(15)6-8-13/h5-8,11,17H,3-4,9-10H2,1-2H3,(H,16,18) |
| InChIKey | GOKKOBXMNYHBEF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|