C14H20Cl2N2O4S — CID 126397173
(2R)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-ethoxypropyl)propanamide (PubChem CID 126397173) has the molecular formula C14H20Cl2N2O4S and a molecular weight of 383.30 g/mol. Its IUPAC name is (2R)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-ethoxypropyl)propanamide.
| Compound Name | (2R)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-ethoxypropyl)propanamide |
|---|---|
| PubChem CID | 126397173 |
| Molecular Formula | C14H20Cl2N2O4S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | (2R)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-ethoxypropyl)propanamide |
| SMILES | CCOCCCNC(=O)[C@@H](C)NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O4S/c1-3-22-8-4-7-17-14(19)10(2)18-23(20,21)13-9-11(15)5-6-12(13)16/h5-6,9-10,18H,3-4,7-8H2,1-2H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | SIKGUNYQBWVTJT-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|