C14H21ClN2O5S — CID 43890329
2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]-N-(3-hydroxypropyl)propanamide (PubChem CID 43890329) has the molecular formula C14H21ClN2O5S and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]-N-(3-hydroxypropyl)propanamide.
| Compound Name | 2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 43890329 |
| Molecular Formula | C14H21ClN2O5S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]-N-(3-hydroxypropyl)propanamide |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)NC(C)C(=O)NCCCO |
| InChI | InChI=1S/C14H21ClN2O5S/c1-3-22-12-6-5-11(15)9-13(12)23(20,21)17-10(2)14(19)16-7-4-8-18/h5-6,9-10,17-18H,3-4,7-8H2,1-2H3,(H,16,19) |
| InChIKey | SUFSJIHHWKUGGI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|