C17H27ClN2O5S — CID 43890415
2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]-N-(3-propan-2-yloxypropyl)propanamide (PubChem CID 43890415) has the molecular formula C17H27ClN2O5S and a molecular weight of 406.93 g/mol. Its IUPAC name is 2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]-N-(3-propan-2-yloxypropyl)propanamide.
| Compound Name | 2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]-N-(3-propan-2-yloxypropyl)propanamide |
|---|---|
| PubChem CID | 43890415 |
| Molecular Formula | C17H27ClN2O5S |
| Molecular Weight | 406.93 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]-N-(3-propan-2-yloxypropyl)propanamide |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)NC(C)C(=O)NCCCOC(C)C |
| InChI | InChI=1S/C17H27ClN2O5S/c1-5-24-15-8-7-14(18)11-16(15)26(22,23)20-13(4)17(21)19-9-6-10-25-12(2)3/h7-8,11-13,20H,5-6,9-10H2,1-4H3,(H,19,21) |
| InChIKey | OZUMKUAKWHUVGU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.93 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|