C17H18BrClN2O4S — CID 43890368
N-(4-bromophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]propanamide (PubChem CID 43890368) has the molecular formula C17H18BrClN2O4S and a molecular weight of 461.77 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-(4-bromophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 43890368 |
| Molecular Formula | C17H18BrClN2O4S |
| Molecular Weight | 461.77 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | N-(4-bromophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonylamino]propanamide |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)NC(C)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrClN2O4S/c1-3-25-15-9-6-13(19)10-16(15)26(23,24)21-11(2)17(22)20-14-7-4-12(18)5-8-14/h4-11,21H,3H2,1-2H3,(H,20,22) |
| InChIKey | PIWQFZZUVAHFEN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |