C13H18Cl2N2O4S — CID 126392529
(2R)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-methoxypropyl)propanamide (PubChem CID 126392529) has the molecular formula C13H18Cl2N2O4S and a molecular weight of 369.27 g/mol. Its IUPAC name is (2R)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-methoxypropyl)propanamide.
| Compound Name | (2R)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 126392529 |
| Molecular Formula | C13H18Cl2N2O4S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (2R)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)[C@@H](C)NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O4S/c1-9(13(18)16-6-3-7-21-2)17-22(19,20)12-8-10(14)4-5-11(12)15/h4-5,8-9,17H,3,6-7H2,1-2H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | BSBYABAYHVYIAB-SECBINFHSA-N |
| XLogP | 1.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|