C9H11Cl2N3O3S — CID 4320202
2,5-dichloro-N-(1-hydrazinyl-1-oxopropan-2-yl)benzenesulfonamide (PubChem CID 4320202) has the molecular formula C9H11Cl2N3O3S and a molecular weight of 312.18 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-hydrazinyl-1-oxopropan-2-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(1-hydrazinyl-1-oxopropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 4320202 |
| Molecular Formula | C9H11Cl2N3O3S |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 2,5-dichloro-N-(1-hydrazinyl-1-oxopropan-2-yl)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)NN |
| InChI | InChI=1S/C9H11Cl2N3O3S/c1-5(9(15)13-12)14-18(16,17)8-4-6(10)2-3-7(8)11/h2-5,14H,12H2,1H3,(H,13,15) |
| InChIKey | QOVMESCRLJUELP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|