C15H13Cl2N3O5S — CID 2969563
2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-nitrophenyl)propanamide (PubChem CID 2969563) has the molecular formula C15H13Cl2N3O5S and a molecular weight of 418.26 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-nitrophenyl)propanamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 2969563 |
| Molecular Formula | C15H13Cl2N3O5S |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-nitrophenyl)propanamide |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13Cl2N3O5S/c1-9(15(21)18-11-3-2-4-12(8-11)20(22)23)19-26(24,25)14-7-10(16)5-6-13(14)17/h2-9,19H,1H3,(H,18,21) |
| InChIKey | HIOHHDUGFZNPKC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|