C17H18Cl2N2O3S — CID 5140094
2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2,4-dimethylphenyl)propanamide (PubChem CID 5140094) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2,4-dimethylphenyl)propanamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 5140094 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2,4-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)C(C)NS(=O)(=O)c2cc(Cl)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-10-4-7-15(11(2)8-10)20-17(22)12(3)21-25(23,24)16-9-13(18)5-6-14(16)19/h4-9,12,21H,1-3H3,(H,20,22) |
| InChIKey | YSZIYFJTRDCYPH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |