C16H16Cl2N2O3S — CID 7318745
(2S)-N-(4-chloro-2-methylphenyl)-2-[(4-chlorophenyl)sulfonylamino]propanamide (PubChem CID 7318745) has the molecular formula C16H16Cl2N2O3S and a molecular weight of 387.29 g/mol. Its IUPAC name is (2S)-N-(4-chloro-2-methylphenyl)-2-[(4-chlorophenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-(4-chloro-2-methylphenyl)-2-[(4-chlorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 7318745 |
| Molecular Formula | C16H16Cl2N2O3S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (2S)-N-(4-chloro-2-methylphenyl)-2-[(4-chlorophenyl)sulfonylamino]propanamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)[C@H](C)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O3S/c1-10-9-13(18)5-8-15(10)19-16(21)11(2)20-24(22,23)14-6-3-12(17)4-7-14/h3-9,11,20H,1-2H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | QPYWKWULKUSYAZ-NSHDSACASA-N |
| XLogP | 3.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |