C16H15Cl2N3O5S — CID 124551127
(2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-methyl-3-nitrophenyl)propanamide (PubChem CID 124551127) has the molecular formula C16H15Cl2N3O5S and a molecular weight of 432.29 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-methyl-3-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-methyl-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 124551127 |
| Molecular Formula | C16H15Cl2N3O5S |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-methyl-3-nitrophenyl)propanamide |
| SMILES | Cc1c(NC(=O)[C@H](C)NS(=O)(=O)c2cc(Cl)ccc2Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15Cl2N3O5S/c1-9-13(4-3-5-14(9)21(23)24)19-16(22)10(2)20-27(25,26)15-8-11(17)6-7-12(15)18/h3-8,10,20H,1-2H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | IFRCKBJSXDCVMY-JTQLQIEISA-N |
| XLogP | 3.52 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|