C15H21N3O5 — CID 94097115
tert-butyl N-[(2R)-1-(2-methyl-3-nitroanilino)-1-oxopropan-2-yl]carbamate (PubChem CID 94097115) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(2-methyl-3-nitroanilino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(2-methyl-3-nitroanilino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 94097115 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | tert-butyl N-[(2R)-1-(2-methyl-3-nitroanilino)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1c(NC(=O)[C@@H](C)NC(=O)OC(C)(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O5/c1-9-11(7-6-8-12(9)18(21)22)17-13(19)10(2)16-14(20)23-15(3,4)5/h6-8,10H,1-5H3,(H,16,20)(H,17,19)/t10-/m1/s1 |
| InChIKey | IPOIJYWKLYQXMX-SNVBAGLBSA-N |
| XLogP | 2.75 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|