C14H20N4O4 — CID 56777668
2-(carbamoylamino)-3-methyl-N-(2-methyl-3-nitrophenyl)pentanamide (PubChem CID 56777668) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-(carbamoylamino)-3-methyl-N-(2-methyl-3-nitrophenyl)pentanamide.
| Compound Name | 2-(carbamoylamino)-3-methyl-N-(2-methyl-3-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 56777668 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(carbamoylamino)-3-methyl-N-(2-methyl-3-nitrophenyl)pentanamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)Nc1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H20N4O4/c1-4-8(2)12(17-14(15)20)13(19)16-10-6-5-7-11(9(10)3)18(21)22/h5-8,12H,4H2,1-3H3,(H,16,19)(H3,15,17,20) |
| InChIKey | ZMHDMSJBTKYAOA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|