C12H17N3O4 — CID 111336778
1-(3-hydroxybutyl)-3-(2-methyl-3-nitrophenyl)urea (PubChem CID 111336778) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-(3-hydroxybutyl)-3-(2-methyl-3-nitrophenyl)urea.
| Compound Name | 1-(3-hydroxybutyl)-3-(2-methyl-3-nitrophenyl)urea |
|---|---|
| PubChem CID | 111336778 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-(3-hydroxybutyl)-3-(2-methyl-3-nitrophenyl)urea |
| SMILES | Cc1c(NC(=O)NCCC(C)O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O4/c1-8(16)6-7-13-12(17)14-10-4-3-5-11(9(10)2)15(18)19/h3-5,8,16H,6-7H2,1-2H3,(H2,13,14,17) |
| InChIKey | KMYVOFSHXVATHE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|