C16H25N3O4 — CID 109388781
1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2-methyl-3-nitrophenyl)urea (PubChem CID 109388781) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2-methyl-3-nitrophenyl)urea.
| Compound Name | 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2-methyl-3-nitrophenyl)urea |
|---|---|
| PubChem CID | 109388781 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2-methyl-3-nitrophenyl)urea |
| SMILES | Cc1c(NC(=O)NCC(C)(C)C(O)C(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N3O4/c1-10(2)14(20)16(4,5)9-17-15(21)18-12-7-6-8-13(11(12)3)19(22)23/h6-8,10,14,20H,9H2,1-5H3,(H2,17,18,21) |
| InChIKey | YQYDHKRTOYNYNI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|