C11H13N3O6 — CID 107810953
(2R)-3-hydroxy-2-[(2-methyl-3-nitrophenyl)carbamoylamino]propanoic acid (PubChem CID 107810953) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[(2-methyl-3-nitrophenyl)carbamoylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[(2-methyl-3-nitrophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 107810953 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (2R)-3-hydroxy-2-[(2-methyl-3-nitrophenyl)carbamoylamino]propanoic acid |
| SMILES | Cc1c(NC(=O)N[C@H](CO)C(=O)O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O6/c1-6-7(3-2-4-9(6)14(19)20)12-11(18)13-8(5-15)10(16)17/h2-4,8,15H,5H2,1H3,(H,16,17)(H2,12,13,18)/t8-/m1/s1 |
| InChIKey | FCDXBPCLHOXCLP-MRVPVSSYSA-N |
| XLogP | 0.47 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|