C13H15F2N3O3 — CID 127266317
1-(1-cyclopropyl-2,2-difluoroethyl)-3-(2-methyl-3-nitrophenyl)urea (PubChem CID 127266317) has the molecular formula C13H15F2N3O3 and a molecular weight of 299.28 g/mol. Its IUPAC name is 1-(1-cyclopropyl-2,2-difluoroethyl)-3-(2-methyl-3-nitrophenyl)urea.
| Compound Name | 1-(1-cyclopropyl-2,2-difluoroethyl)-3-(2-methyl-3-nitrophenyl)urea |
|---|---|
| PubChem CID | 127266317 |
| Molecular Formula | C13H15F2N3O3 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(1-cyclopropyl-2,2-difluoroethyl)-3-(2-methyl-3-nitrophenyl)urea |
| SMILES | Cc1c(NC(=O)NC(C(F)F)C2CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15F2N3O3/c1-7-9(3-2-4-10(7)18(20)21)16-13(19)17-11(12(14)15)8-5-6-8/h2-4,8,11-12H,5-6H2,1H3,(H2,16,17,19) |
| InChIKey | KMLUKHQTJBUNFH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|