C10H8F4N2O3 — CID 103731946
2,2,3,3-tetrafluoro-N-(2-methyl-3-nitrophenyl)propanamide (PubChem CID 103731946) has the molecular formula C10H8F4N2O3 and a molecular weight of 280.18 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(2-methyl-3-nitrophenyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(2-methyl-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 103731946 |
| Molecular Formula | C10H8F4N2O3 |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(2-methyl-3-nitrophenyl)propanamide |
| SMILES | Cc1c(NC(=O)C(F)(F)C(F)F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8F4N2O3/c1-5-6(3-2-4-7(5)16(18)19)15-9(17)10(13,14)8(11)12/h2-4,8H,1H3,(H,15,17) |
| InChIKey | NQCBVYJJCOSGGY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|