C15H23N3O4 — CID 111120461
1-(2-hydroxy-2,3-dimethylpentyl)-3-(2-methyl-3-nitrophenyl)urea (PubChem CID 111120461) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(2-hydroxy-2,3-dimethylpentyl)-3-(2-methyl-3-nitrophenyl)urea.
| Compound Name | 1-(2-hydroxy-2,3-dimethylpentyl)-3-(2-methyl-3-nitrophenyl)urea |
|---|---|
| PubChem CID | 111120461 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(2-hydroxy-2,3-dimethylpentyl)-3-(2-methyl-3-nitrophenyl)urea |
| SMILES | CCC(C)C(C)(O)CNC(=O)Nc1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C15H23N3O4/c1-5-10(2)15(4,20)9-16-14(19)17-12-7-6-8-13(11(12)3)18(21)22/h6-8,10,20H,5,9H2,1-4H3,(H2,16,17,19) |
| InChIKey | ZLIGJHJCGFDVFN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|