C14H21N5O4 — CID 9278465
(2S)-2-(carbamoylamino)-3-methyl-N-[2-(2-nitroanilino)ethyl]butanamide (PubChem CID 9278465) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)-3-methyl-N-[2-(2-nitroanilino)ethyl]butanamide.
| Compound Name | (2S)-2-(carbamoylamino)-3-methyl-N-[2-(2-nitroanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 9278465 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2S)-2-(carbamoylamino)-3-methyl-N-[2-(2-nitroanilino)ethyl]butanamide |
| SMILES | CC(C)[C@H](NC(N)=O)C(=O)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N5O4/c1-9(2)12(18-14(15)21)13(20)17-8-7-16-10-5-3-4-6-11(10)19(22)23/h3-6,9,12,16H,7-8H2,1-2H3,(H,17,20)(H3,15,18,21)/t12-/m0/s1 |
| InChIKey | SCTGVBQEKKYTFX-LBPRGKRZSA-N |
| XLogP | 0.82 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|