C20H23FN4O4 — CID 16963198
2-fluoro-N-[3-methyl-1-[2-(2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 16963198) has the molecular formula C20H23FN4O4 and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-fluoro-N-[3-methyl-1-[2-(2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[3-methyl-1-[2-(2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 16963198 |
| Molecular Formula | C20H23FN4O4 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-fluoro-N-[3-methyl-1-[2-(2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23FN4O4/c1-13(2)18(24-19(26)14-7-3-4-8-15(14)21)20(27)23-12-11-22-16-9-5-6-10-17(16)25(28)29/h3-10,13,18,22H,11-12H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | XOTSRYJSMITKMG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|