C21H26N4O4 — CID 34200440
4-methyl-N-[(2S)-3-methyl-1-[2-(2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 34200440) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-3-methyl-1-[2-(2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-methyl-N-[(2S)-3-methyl-1-[2-(2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 34200440 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-methyl-N-[(2S)-3-methyl-1-[2-(2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@H](C(=O)NCCNc2ccccc2[N+](=O)[O-])C(C)C)cc1 |
| InChI | InChI=1S/C21H26N4O4/c1-14(2)19(24-20(26)16-10-8-15(3)9-11-16)21(27)23-13-12-22-17-6-4-5-7-18(17)25(28)29/h4-11,14,19,22H,12-13H2,1-3H3,(H,23,27)(H,24,26)/t19-/m0/s1 |
| InChIKey | RTNUXNYETFGCHX-IBGZPJMESA-N |
| XLogP | 2.89 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|