C19H24N4O5S — CID 9278844
4-[[(2R)-butan-2-yl]sulfamoyl]-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 9278844) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is 4-[[(2R)-butan-2-yl]sulfamoyl]-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 4-[[(2R)-butan-2-yl]sulfamoyl]-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 9278844 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-[[(2R)-butan-2-yl]sulfamoyl]-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1ccc(C(=O)NCCNc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H24N4O5S/c1-3-14(2)22-29(27,28)16-10-8-15(9-11-16)19(24)21-13-12-20-17-6-4-5-7-18(17)23(25)26/h4-11,14,20,22H,3,12-13H2,1-2H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | CFASMRPPWFRVTR-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|