C16H18N4O5S — CID 41275762
3-(methanesulfonamido)-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 41275762) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 3-(methanesulfonamido)-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 41275762 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-(methanesulfonamido)-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | CS(=O)(=O)Nc1cccc(C(=O)NCCNc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N4O5S/c1-26(24,25)19-13-6-4-5-12(11-13)16(21)18-10-9-17-14-7-2-3-8-15(14)20(22)23/h2-8,11,17,19H,9-10H2,1H3,(H,18,21) |
| InChIKey | IYPINLPIFKAASC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|