C16H15F2N3O4 — CID 9278108
3-(difluoromethoxy)-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 9278108) has the molecular formula C16H15F2N3O4 and a molecular weight of 351.31 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 9278108 |
| Molecular Formula | C16H15F2N3O4 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-(difluoromethoxy)-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | O=C(NCCNc1ccccc1[N+](=O)[O-])c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H15F2N3O4/c17-16(18)25-12-5-3-4-11(10-12)15(22)20-9-8-19-13-6-1-2-7-14(13)21(23)24/h1-7,10,16,19H,8-9H2,(H,20,22) |
| InChIKey | GGPFXGILHWCORU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|