C22H28N4O7S — CID 55934804
2-methoxy-N-[(2S)-3-methyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 55934804) has the molecular formula C22H28N4O7S and a molecular weight of 492.55 g/mol. Its IUPAC name is 2-methoxy-N-[(2S)-3-methyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-methoxy-N-[(2S)-3-methyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55934804 |
| Molecular Formula | C22H28N4O7S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-methoxy-N-[(2S)-3-methyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccccc1C(=O)N[C@H](C(=O)NCCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C22H28N4O7S/c1-14(2)20(25-21(27)16-7-5-6-8-19(16)33-3)22(28)24-12-11-23-17-10-9-15(34(4,31)32)13-18(17)26(29)30/h5-10,13-14,20,23H,11-12H2,1-4H3,(H,24,28)(H,25,27)/t20-/m0/s1 |
| InChIKey | QFIIAUXXESJONS-FQEVSTJZSA-N |
| XLogP | 1.99 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|