C20H25N5O6S — CID 46637814
N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(propan-2-ylcarbamoylamino)benzamide (PubChem CID 46637814) has the molecular formula C20H25N5O6S and a molecular weight of 463.52 g/mol. Its IUPAC name is N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(propan-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(propan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 46637814 |
| Molecular Formula | C20H25N5O6S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(propan-2-ylcarbamoylamino)benzamide |
| SMILES | CC(C)NC(=O)Nc1ccccc1C(=O)NCCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H25N5O6S/c1-13(2)23-20(27)24-16-7-5-4-6-15(16)19(26)22-11-10-21-17-9-8-14(32(3,30)31)12-18(17)25(28)29/h4-9,12-13,21H,10-11H2,1-3H3,(H,22,26)(H2,23,24,27) |
| InChIKey | XROMWQDEYUIZMV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|