C19H19N3O4S — CID 7569692
N-(4-methylsulfonyl-2-nitrophenyl)-N'-naphthalen-1-ylethane-1,2-diamine (PubChem CID 7569692) has the molecular formula C19H19N3O4S and a molecular weight of 385.44 g/mol. Its IUPAC name is N-(4-methylsulfonyl-2-nitrophenyl)-N'-naphthalen-1-ylethane-1,2-diamine.
| Compound Name | N-(4-methylsulfonyl-2-nitrophenyl)-N'-naphthalen-1-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 7569692 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(4-methylsulfonyl-2-nitrophenyl)-N'-naphthalen-1-ylethane-1,2-diamine |
| SMILES | CS(=O)(=O)c1ccc(NCCNc2cccc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O4S/c1-27(25,26)15-9-10-18(19(13-15)22(23)24)21-12-11-20-17-8-4-6-14-5-2-3-7-16(14)17/h2-10,13,20-21H,11-12H2,1H3 |
| InChIKey | JOAVCYHAVYAIDI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|