C11H13N2NaO6S — CID 50912797
sodium 4-(4-methylsulfonyl-2-nitroanilino)butanoate (PubChem CID 50912797) has the molecular formula C11H13N2NaO6S and a molecular weight of 324.29 g/mol. Its IUPAC name is sodium 4-(4-methylsulfonyl-2-nitroanilino)butanoate.
| Compound Name | sodium 4-(4-methylsulfonyl-2-nitroanilino)butanoate |
|---|---|
| PubChem CID | 50912797 |
| Molecular Formula | C11H13N2NaO6S |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | sodium 4-(4-methylsulfonyl-2-nitroanilino)butanoate |
| SMILES | CS(=O)(=O)c1ccc(NCCCC(=O)[O-])c([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C11H14N2O6S.Na/c1-20(18,19)8-4-5-9(10(7-8)13(16)17)12-6-2-3-11(14)15;/h4-5,7,12H,2-3,6H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | IDCSJGYYHXGSCX-UHFFFAOYSA-M |
| XLogP | -3.06 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|