C9H13N3O6S2 — CID 43552379
2-(4-methylsulfonyl-2-nitroanilino)ethanesulfonamide (PubChem CID 43552379) has the molecular formula C9H13N3O6S2 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(4-methylsulfonyl-2-nitroanilino)ethanesulfonamide.
| Compound Name | 2-(4-methylsulfonyl-2-nitroanilino)ethanesulfonamide |
|---|---|
| PubChem CID | 43552379 |
| Molecular Formula | C9H13N3O6S2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-(4-methylsulfonyl-2-nitroanilino)ethanesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(NCCS(N)(=O)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H13N3O6S2/c1-19(15,16)7-2-3-8(9(6-7)12(13)14)11-4-5-20(10,17)18/h2-3,6,11H,4-5H2,1H3,(H2,10,17,18) |
| InChIKey | WXUDFYZUXYHIPG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|