C15H15N5O4S — CID 133391852
6-[2-(4-methylsulfonyl-2-nitroanilino)ethylamino]pyridine-2-carbonitrile (PubChem CID 133391852) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is 6-[2-(4-methylsulfonyl-2-nitroanilino)ethylamino]pyridine-2-carbonitrile.
| Compound Name | 6-[2-(4-methylsulfonyl-2-nitroanilino)ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133391852 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 6-[2-(4-methylsulfonyl-2-nitroanilino)ethylamino]pyridine-2-carbonitrile |
| SMILES | CS(=O)(=O)c1ccc(NCCNc2cccc(C#N)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N5O4S/c1-25(23,24)12-5-6-13(14(9-12)20(21)22)17-7-8-18-15-4-2-3-11(10-16)19-15/h2-6,9,17H,7-8H2,1H3,(H,18,19) |
| InChIKey | NLRXTKHMZOXFGQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|