C17H23N5O5S — CID 55914121
5-(2-methylpropyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 55914121) has the molecular formula C17H23N5O5S and a molecular weight of 409.47 g/mol. Its IUPAC name is 5-(2-methylpropyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(2-methylpropyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55914121 |
| Molecular Formula | C17H23N5O5S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 5-(2-methylpropyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)Cc1cc(C(=O)NCCNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C17H23N5O5S/c1-11(2)8-12-9-15(21-20-12)17(23)19-7-6-18-14-5-4-13(28(3,26)27)10-16(14)22(24)25/h4-5,9-11,18H,6-8H2,1-3H3,(H,19,23)(H,20,21) |
| InChIKey | PYMLRHLYNSHVDU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|