C14H18ClN5O5S2 — CID 119694581
2-(aminomethyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119694581) has the molecular formula C14H18ClN5O5S2 and a molecular weight of 435.92 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(aminomethyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119694581 |
| Molecular Formula | C14H18ClN5O5S2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)c2csc(CN)n2)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C14H17N5O5S2.ClH/c1-26(23,24)9-2-3-10(12(6-9)19(21)22)16-4-5-17-14(20)11-8-25-13(7-15)18-11;/h2-3,6,8,16H,4-5,7,15H2,1H3,(H,17,20);1H |
| InChIKey | ZFQFFBQVPJDUPF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 157.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|