C13H21N5O4S — CID 111036590
1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-propylguanidine (PubChem CID 111036590) has the molecular formula C13H21N5O4S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-propylguanidine.
| Compound Name | 1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-propylguanidine |
|---|---|
| PubChem CID | 111036590 |
| Molecular Formula | C13H21N5O4S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-propylguanidine |
| SMILES | CCC/N=C(\N)NCCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N5O4S/c1-3-6-16-13(14)17-8-7-15-11-5-4-10(23(2,21)22)9-12(11)18(19)20/h4-5,9,15H,3,6-8H2,1-2H3,(H3,14,16,17) |
| InChIKey | MRMQRBUAPCGMDD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|