C18H30IN5O4S — CID 111153548
N',3,5-trimethyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111153548) has the molecular formula C18H30IN5O4S and a molecular weight of 539.44 g/mol. Its IUPAC name is N',3,5-trimethyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N',3,5-trimethyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111153548 |
| Molecular Formula | C18H30IN5O4S |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | N',3,5-trimethyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])N1CC(C)CC(C)C1.I |
| InChI | InChI=1S/C18H29N5O4S.HI/c1-13-9-14(2)12-22(11-13)18(19-3)21-8-7-20-16-6-5-15(28(4,26)27)10-17(16)23(24)25;/h5-6,10,13-14,20H,7-9,11-12H2,1-4H3,(H,19,21);1H |
| InChIKey | RJEQNASLWQCKDR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|