C14H23N5O4S — CID 111036588
2-butyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]guanidine (PubChem CID 111036588) has the molecular formula C14H23N5O4S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-butyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]guanidine.
| Compound Name | 2-butyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111036588 |
| Molecular Formula | C14H23N5O4S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-butyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]guanidine |
| SMILES | CCCC/N=C(\N)NCCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H23N5O4S/c1-3-4-7-17-14(15)18-9-8-16-12-6-5-11(24(2,22)23)10-13(12)19(20)21/h5-6,10,16H,3-4,7-9H2,1-2H3,(H3,15,17,18) |
| InChIKey | HEJZELLDSGWLPI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|