C19H23N3O6S — CID 27336180
2-(3,5-dimethylphenoxy)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]acetamide (PubChem CID 27336180) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 27336180 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NCCNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N3O6S/c1-13-8-14(2)10-15(9-13)28-12-19(23)21-7-6-20-17-5-4-16(29(3,26)27)11-18(17)22(24)25/h4-5,8-11,20H,6-7,12H2,1-3H3,(H,21,23) |
| InChIKey | RLMWKQPEMCXWSW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|