C18H19Cl2N3O6S — CID 55607478
3-(3,4-dichlorophenoxy)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide (PubChem CID 55607478) has the molecular formula C18H19Cl2N3O6S and a molecular weight of 476.34 g/mol. Its IUPAC name is 3-(3,4-dichlorophenoxy)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide.
| Compound Name | 3-(3,4-dichlorophenoxy)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 55607478 |
| Molecular Formula | C18H19Cl2N3O6S |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 3-(3,4-dichlorophenoxy)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)CCOc2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19Cl2N3O6S/c1-30(27,28)13-3-5-16(17(11-13)23(25)26)21-7-8-22-18(24)6-9-29-12-2-4-14(19)15(20)10-12/h2-5,10-11,21H,6-9H2,1H3,(H,22,24) |
| InChIKey | JMJDORCJZXUFDA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|