C18H17Cl2N3O5S — CID 27336365
(E)-3-(2,3-dichlorophenyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]prop-2-enamide (PubChem CID 27336365) has the molecular formula C18H17Cl2N3O5S and a molecular weight of 458.32 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 27336365 |
| Molecular Formula | C18H17Cl2N3O5S |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)/C=C/c2cccc(Cl)c2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17Cl2N3O5S/c1-29(27,28)13-6-7-15(16(11-13)23(25)26)21-9-10-22-17(24)8-5-12-3-2-4-14(19)18(12)20/h2-8,11,21H,9-10H2,1H3,(H,22,24)/b8-5+ |
| InChIKey | VVMZERFNMMXZFB-VMPITWQZSA-N |
| XLogP | 3.55 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|