C24H32N4O5S — CID 26977476
(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]prop-2-enamide (PubChem CID 26977476) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 26977476 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C/C(=O)NCCNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C24H32N4O5S/c1-17-15-19(18(2)27(17)20-7-5-4-6-8-20)9-12-24(29)26-14-13-25-22-11-10-21(34(3,32)33)16-23(22)28(30)31/h9-12,15-16,20,25H,4-8,13-14H2,1-3H3,(H,26,29)/b12-9+ |
| InChIKey | QKNWTXVTRJPTQG-FMIVXFBMSA-N |
| XLogP | 4.16 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|