C23H31N3O3S — CID 9474633
(E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[[4-(diethylsulfamoyl)phenyl]methyl]prop-2-enamide (PubChem CID 9474633) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[[4-(diethylsulfamoyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[[4-(diethylsulfamoyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9474633 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[[4-(diethylsulfamoyl)phenyl]methyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)/C=C/c2cc(C)n(C3CC3)c2C)cc1 |
| InChI | InChI=1S/C23H31N3O3S/c1-5-25(6-2)30(28,29)22-12-7-19(8-13-22)16-24-23(27)14-9-20-15-17(3)26(18(20)4)21-10-11-21/h7-9,12-15,21H,5-6,10-11,16H2,1-4H3,(H,24,27)/b14-9+ |
| InChIKey | NWYSFFIKSLMKRI-NTEUORMPSA-N |
| XLogP | 3.80 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|