C17H25N3O2 — CID 9163414
(E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[2-oxo-2-(propylamino)ethyl]prop-2-enamide (PubChem CID 9163414) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[2-oxo-2-(propylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[2-oxo-2-(propylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9163414 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[2-oxo-2-(propylamino)ethyl]prop-2-enamide |
| SMILES | CCCNC(=O)CNC(=O)/C=C/c1cc(C)n(C2CC2)c1C |
| InChI | InChI=1S/C17H25N3O2/c1-4-9-18-17(22)11-19-16(21)8-5-14-10-12(2)20(13(14)3)15-6-7-15/h5,8,10,15H,4,6-7,9,11H2,1-3H3,(H,18,22)(H,19,21)/b8-5+ |
| InChIKey | FLLMBIQUSHXUIL-VMPITWQZSA-N |
| XLogP | 2.10 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|