C22H29N3O — CID 8938116
(E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[(1S)-2-(dimethylamino)-1-phenylethyl]prop-2-enamide (PubChem CID 8938116) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[(1S)-2-(dimethylamino)-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[(1S)-2-(dimethylamino)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 8938116 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[(1S)-2-(dimethylamino)-1-phenylethyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C/C(=O)N[C@H](CN(C)C)c2ccccc2)c(C)n1C1CC1 |
| InChI | InChI=1S/C22H29N3O/c1-16-14-19(17(2)25(16)20-11-12-20)10-13-22(26)23-21(15-24(3)4)18-8-6-5-7-9-18/h5-10,13-14,20-21H,11-12,15H2,1-4H3,(H,23,26)/b13-10+/t21-/m1/s1 |
| InChIKey | JVPNVGPXPKVLFC-QYFOZDBKSA-N |
| XLogP | 3.87 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|