C21H23ClN2O3 — CID 8937857
(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[(1S)-2-(dimethylamino)-1-phenylethyl]prop-2-enamide (PubChem CID 8937857) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[(1S)-2-(dimethylamino)-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[(1S)-2-(dimethylamino)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 8937857 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[(1S)-2-(dimethylamino)-1-phenylethyl]prop-2-enamide |
| SMILES | CN(C)C[C@@H](NC(=O)/C=C/c1cc(Cl)c2c(c1)OCCO2)c1ccccc1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-24(2)14-18(16-6-4-3-5-7-16)23-20(25)9-8-15-12-17(22)21-19(13-15)26-10-11-27-21/h3-9,12-13,18H,10-11,14H2,1-2H3,(H,23,25)/b9-8+/t18-/m1/s1 |
| InChIKey | IVAKUYCYRKPZGK-GFOMBABLSA-N |
| XLogP | 3.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|